C18H18N2O4S — CID 139774601
(2R)-2-[[4-(5-methyl-1H-indol-2-yl)phenyl]sulfonylamino]propanoic acid (PubChem CID 139774601) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is (2R)-2-[[4-(5-methyl-1H-indol-2-yl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-(5-methyl-1H-indol-2-yl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 139774601 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (2R)-2-[[4-(5-methyl-1H-indol-2-yl)phenyl]sulfonylamino]propanoic acid |
| SMILES | Cc1ccc2[nH]c(-c3ccc(S(=O)(=O)N[C@H](C)C(=O)O)cc3)cc2c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-11-3-8-16-14(9-11)10-17(19-16)13-4-6-15(7-5-13)25(23,24)20-12(2)18(21)22/h3-10,12,19-20H,1-2H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | BEIOLFMURFNFDL-GFCCVEGCSA-N |
| XLogP | 2.89 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |