C20H22N2O5S — CID 166746635
2-[(4-methylphenyl)sulfonylamino]propanoic acid;5-phenyl-1H-pyrrol-3-ol (PubChem CID 166746635) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]propanoic acid;5-phenyl-1H-pyrrol-3-ol.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]propanoic acid;5-phenyl-1H-pyrrol-3-ol |
|---|---|
| PubChem CID | 166746635 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]propanoic acid;5-phenyl-1H-pyrrol-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)C(=O)O)cc1.Oc1c[nH]c(-c2ccccc2)c1 |
| InChI | InChI=1S/C10H13NO4S.C10H9NO/c1-7-3-5-9(6-4-7)16(14,15)11-8(2)10(12)13;12-9-6-10(11-7-9)8-4-2-1-3-5-8/h3-6,8,11H,1-2H3,(H,12,13);1-7,11-12H |
| InChIKey | DRQVHVUCEHHIHM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |