About 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate
1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate (PubChem CID 70568486) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate.
Molecular Properties
| Compound Name | 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate |
| PubChem CID | 70568486 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate |
| SMILES | CC(=CC(=O)c1ccccc1)N[C@@H](C)C(=O)Oc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20N2O3/c1-14(12-19(24)16-8-4-3-5-9-16)23-15(2)21(25)26-20-13-22-18-11-7-6-10-17(18)20/h3-13,15,22-23H,1-2H3/t15-/m0/s1 |
| InChIKey | RRHUEXGQMMXICR-HNNXBMFYSA-N |
| XLogP | 3.84 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate?
The IUPAC name of 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate (CID 70568486) is 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate.
What is the SMILES notation for 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate?
The canonical SMILES for 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate is CC(=CC(=O)c1ccccc1)N[C@@H](C)C(=O)Oc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate?
The InChIKey is RRHUEXGQMMXICR-HNNXBMFYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-14(12-19(24)16-8-4-3-5-9-16)23-15(2)21(25)26-20-13-22-18-11-7-6-10-17(18)20/h3-13,15,22-23H,1-2H3/t15-/m0/s1.
What are the key properties of 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate?
1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate has a molecular weight of 348.40 g/mol, XLogP of 3.84, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-yl (2S)-2-[(4-oxo-4-phenylbut-2-en-2-yl)amino]propanoate is sourced from PubChem (CID 70568486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).