C28H27NO6S — CID 3318890
(6-oxobenzo[c]chromen-3-yl) 4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxylate (PubChem CID 3318890) has the molecular formula C28H27NO6S and a molecular weight of 505.59 g/mol. Its IUPAC name is (6-oxobenzo[c]chromen-3-yl) 4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxylate.
| Compound Name | (6-oxobenzo[c]chromen-3-yl) 4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 3318890 |
| Molecular Formula | C28H27NO6S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (6-oxobenzo[c]chromen-3-yl) 4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCC(C(=O)Oc3ccc4c(c3)oc(=O)c3ccccc34)CC2)cc1 |
| InChI | InChI=1S/C28H27NO6S/c1-18-6-13-22(14-7-18)36(32,33)29-17-19-8-10-20(11-9-19)27(30)34-21-12-15-24-23-4-2-3-5-25(23)28(31)35-26(24)16-21/h2-7,12-16,19-20,29H,8-11,17H2,1H3 |
| InChIKey | FJGRGPLONQEJQY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|