C30H30N2O4S — CID 67589664
methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(2-methylpropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate (PubChem CID 67589664) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(2-methylpropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(2-methylpropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 67589664 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[4-[2-[4-(2-methylpropyl)phenyl]ethynyl]phenyl]sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(C#Cc2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O4S/c1-21(2)18-24-12-10-22(11-13-24)8-9-23-14-16-26(17-15-23)37(34,35)32-29(30(33)36-3)19-25-20-31-28-7-5-4-6-27(25)28/h4-7,10-17,20-21,29,31-32H,18-19H2,1-3H3/t29-/m1/s1 |
| InChIKey | YNJBZMQFRGQJQG-GDLZYMKVSA-N |
| XLogP | 4.83 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|