C23H16F2N2O4S2 — CID 90260545
(2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid (PubChem CID 90260545) has the molecular formula C23H16F2N2O4S2 and a molecular weight of 486.52 g/mol. Its IUPAC name is (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 90260545 |
| Molecular Formula | C23H16F2N2O4S2 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[5-[2-(4-fluorophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1c[nH]c2cc(F)ccc12)NS(=O)(=O)c1ccc(C#Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C23H16F2N2O4S2/c24-16-4-1-14(2-5-16)3-7-18-8-10-22(32-18)33(30,31)27-21(23(28)29)11-15-13-26-20-12-17(25)6-9-19(15)20/h1-2,4-6,8-10,12-13,21,26-27H,11H2,(H,28,29)/t21-/m1/s1 |
| InChIKey | ZMRLQHSMNJOWGJ-OAQYLSRUSA-N |
| XLogP | 3.88 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|