C21H25NO4S2 — CID 11796352
(2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 11796352) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11796352 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2R)-2-[[5-[2-(4-butylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CCCCc1ccc(C#Cc2ccc(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)s2)cc1 |
| InChI | InChI=1S/C21H25NO4S2/c1-4-5-6-16-7-9-17(10-8-16)11-12-18-13-14-19(27-18)28(25,26)22-20(15(2)3)21(23)24/h7-10,13-15,20,22H,4-6H2,1-3H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | CBAVXLBMIZUDPK-HXUWFJFHSA-N |
| XLogP | 3.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|