C13H22N2O6S3 — CID 122067981
2-[[5-[2-(ethylsulfonylamino)ethyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 122067981) has the molecular formula C13H22N2O6S3 and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[[5-[2-(ethylsulfonylamino)ethyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 2-[[5-[2-(ethylsulfonylamino)ethyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122067981 |
| Molecular Formula | C13H22N2O6S3 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-[[5-[2-(ethylsulfonylamino)ethyl]thiophen-2-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CCS(=O)(=O)NCCc1ccc(S(=O)(=O)NC(C(=O)O)C(C)C)s1 |
| InChI | InChI=1S/C13H22N2O6S3/c1-4-23(18,19)14-8-7-10-5-6-11(22-10)24(20,21)15-12(9(2)3)13(16)17/h5-6,9,12,14-15H,4,7-8H2,1-3H3,(H,16,17) |
| InChIKey | NPNHYEFWKHVKMX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |