C27H31N2O4S2+ — CID 68742141
trimethyl-[(2R)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-4-oxo-4-phenylmethoxybutyl]azanium (PubChem CID 68742141) has the molecular formula C27H31N2O4S2+ and a molecular weight of 511.69 g/mol. Its IUPAC name is trimethyl-[(2R)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-4-oxo-4-phenylmethoxybutyl]azanium.
| Compound Name | trimethyl-[(2R)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-4-oxo-4-phenylmethoxybutyl]azanium |
|---|---|
| PubChem CID | 68742141 |
| Molecular Formula | C27H31N2O4S2+ |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | trimethyl-[(2R)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-4-oxo-4-phenylmethoxybutyl]azanium |
| SMILES | Cc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](CC(=O)OCc3ccccc3)C[N+](C)(C)C)s2)cc1 |
| InChI | InChI=1S/C27H31N2O4S2/c1-21-10-12-22(13-11-21)14-15-25-16-17-27(34-25)35(31,32)28-24(19-29(2,3)4)18-26(30)33-20-23-8-6-5-7-9-23/h5-13,16-17,24,28H,18-20H2,1-4H3/q+1/t24-/m1/s1 |
| InChIKey | YAIPEAQHQHXZPU-XMMPIXPASA-N |
| XLogP | 3.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|