C24H20N2O4S2 — CID 46842912
(2S)-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)-2-[[5-[2-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid (PubChem CID 46842912) has the molecular formula C24H20N2O4S2 and a molecular weight of 479.66 g/mol. Its IUPAC name is (2S)-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)-2-[[5-[2-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)-2-[[5-[2-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 46842912 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (2S)-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)-2-[[5-[2-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid |
| SMILES | [2H]c1[nH]c2c([2H])c([2H])c([2H])c([2H])c2c1C([2H])([2H])[C@]([2H])(NS(=O)(=O)c1ccc(C#Cc2c([2H])c([2H])c(C([2H])([2H])[2H])c([2H])c2[2H])s1)C(=O)O |
| InChI | InChI=1S/C24H20N2O4S2/c1-16-6-8-17(9-7-16)10-11-19-12-13-23(31-19)32(29,30)26-22(24(27)28)14-18-15-25-21-5-3-2-4-20(18)21/h2-9,12-13,15,22,25-26H,14H2,1H3,(H,27,28)/t22-/m0/s1/i1D3,2D,3D,4D,5D,6D,7D,8D,9D,14D2,15D,22D |
| InChIKey | YWCLDDLVLSQGSZ-CCJVKIMISA-N |
| XLogP | 3.91 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|