C15H21N — CID 58756842
3-(4,4-dimethylpentyl)-1H-indole (PubChem CID 58756842) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-(4,4-dimethylpentyl)-1H-indole.
| Compound Name | 3-(4,4-dimethylpentyl)-1H-indole |
|---|---|
| PubChem CID | 58756842 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-(4,4-dimethylpentyl)-1H-indole |
| SMILES | CC(C)(C)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H21N/c1-15(2,3)10-6-7-12-11-16-14-9-5-4-8-13(12)14/h4-5,8-9,11,16H,6-7,10H2,1-3H3 |
| InChIKey | FHYVQNICNHNYFC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |