C26H27N3O2 — CID 7928745
(2S)-N-(2-ethoxyphenyl)-2-[2-(1H-indol-3-yl)ethylamino]-2-phenylacetamide (PubChem CID 7928745) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2S)-N-(2-ethoxyphenyl)-2-[2-(1H-indol-3-yl)ethylamino]-2-phenylacetamide.
| Compound Name | (2S)-N-(2-ethoxyphenyl)-2-[2-(1H-indol-3-yl)ethylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 7928745 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2S)-N-(2-ethoxyphenyl)-2-[2-(1H-indol-3-yl)ethylamino]-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)[C@@H](NCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O2/c1-2-31-24-15-9-8-14-23(24)29-26(30)25(19-10-4-3-5-11-19)27-17-16-20-18-28-22-13-7-6-12-21(20)22/h3-15,18,25,27-28H,2,16-17H2,1H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | KTLJHSPYYHBCCP-VWLOTQADSA-N |
| XLogP | 5.08 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |