C19H23N5O3 — CID 55822207
N'-[2-(1H-indol-3-yl)acetyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide (PubChem CID 55822207) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide |
|---|---|
| PubChem CID | 55822207 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-4-(3-propyl-1,2,4-oxadiazol-5-yl)butanehydrazide |
| SMILES | CCCc1noc(CCCC(=O)NNC(=O)Cc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C19H23N5O3/c1-2-6-16-21-19(27-24-16)10-5-9-17(25)22-23-18(26)11-13-12-20-15-8-4-3-7-14(13)15/h3-4,7-8,12,20H,2,5-6,9-11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | FTDNVMBXNOXQNN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|