C23H25N3O5 — CID 9016765
[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 9016765) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 9016765 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)COC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H25N3O5/c1-15(27)25-17-10-11-21(30-2)20(12-17)26-22(28)14-31-23(29)9-5-6-16-13-24-19-8-4-3-7-18(16)19/h3-4,7-8,10-13,24H,5-6,9,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | HPHFLSOCTSQBEL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |