C24H25NO4S — CID 8569297
[2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 4-thiophen-2-ylbutanoate (PubChem CID 8569297) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is [2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 8569297 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 4-thiophen-2-ylbutanoate |
| SMILES | COc1ccc([C@@H](NC(=O)COC(=O)CCCc2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO4S/c1-28-20-14-12-19(13-15-20)24(18-7-3-2-4-8-18)25-22(26)17-29-23(27)11-5-9-21-10-6-16-30-21/h2-4,6-8,10,12-16,24H,5,9,11,17H2,1H3,(H,25,26)/t24-/m0/s1 |
| InChIKey | MCHKFDCDCBFAKB-DEOSSOPVSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |