C26H27NO4 — CID 8608961
[2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methyl-2-phenylpropanoate (PubChem CID 8608961) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methyl-2-phenylpropanoate.
| Compound Name | [2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 8608961 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [2-[[(S)-(4-methoxyphenyl)-phenylmethyl]amino]-2-oxoethyl] 2-methyl-2-phenylpropanoate |
| SMILES | COc1ccc([C@@H](NC(=O)COC(=O)C(C)(C)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-26(2,21-12-8-5-9-13-21)25(29)31-18-23(28)27-24(19-10-6-4-7-11-19)20-14-16-22(30-3)17-15-20/h4-17,24H,18H2,1-3H3,(H,27,28)/t24-/m0/s1 |
| InChIKey | XRIZOAONTSAOEO-DEOSSOPVSA-N |
| XLogP | 4.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |