C23H30N2O5S2 — CID 30108251
[2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate (PubChem CID 30108251) has the molecular formula C23H30N2O5S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is [2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 30108251 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | [2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-thiophen-2-ylbutanoate |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccccc1NC(=O)COC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C23H30N2O5S2/c1-25(18-9-3-2-4-10-18)32(28,29)21-14-6-5-13-20(21)24-22(26)17-30-23(27)15-7-11-19-12-8-16-31-19/h5-6,8,12-14,16,18H,2-4,7,9-11,15,17H2,1H3,(H,24,26) |
| InChIKey | QIFRQUNRIKHOEG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |