C23H29N3O5S — CID 55995504
[2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 2-(6-methyl-3-pyridinyl)acetate (PubChem CID 55995504) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is [2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 2-(6-methyl-3-pyridinyl)acetate.
| Compound Name | [2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 2-(6-methyl-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 55995504 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [2-[2-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 2-(6-methyl-3-pyridinyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCC(=O)Nc2ccccc2S(=O)(=O)N(C)C2CCCCC2)cn1 |
| InChI | InChI=1S/C23H29N3O5S/c1-17-12-13-18(15-24-17)14-23(28)31-16-22(27)25-20-10-6-7-11-21(20)32(29,30)26(2)19-8-4-3-5-9-19/h6-7,10-13,15,19H,3-5,8-9,14,16H2,1-2H3,(H,25,27) |
| InChIKey | LWHUZXUADABNQF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |