C19H23F2N3O2S — CID 47534873
N-[2-(difluoromethoxy)phenyl]-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide (PubChem CID 47534873) has the molecular formula C19H23F2N3O2S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 47534873 |
| Molecular Formula | C19H23F2N3O2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCc2cccs2)CC1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H23F2N3O2S/c20-19(21)26-17-6-2-1-5-16(17)22-18(25)14-24-11-9-23(10-12-24)8-7-15-4-3-13-27-15/h1-6,13,19H,7-12,14H2,(H,22,25) |
| InChIKey | OIDUVUUQSDUARA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |