About 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine)
5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) (PubChem CID 23291525) has the molecular formula C26H36N2O7
and a molecular weight of 488.58 g/mol. Its IUPAC name is 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine).
Molecular Properties
| Compound Name | 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) |
| PubChem CID | 23291525 |
| Molecular Formula | C26H36N2O7 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) |
| SMILES | NCCc1ccccc1.NCCc1ccccc1.O=C(O)CCCC(=O)OC(=O)CCCC(=O)O |
| InChI | InChI=1S/C10H14O7.2C8H11N/c11-7(12)3-1-5-9(15)17-10(16)6-2-4-8(13)14;2*9-7-6-8-4-2-1-3-5-8/h1-6H2,(H,11,12)(H,13,14);2*1-5H,6-7,9H2 |
| InChIKey | QLGCSZIXFOQYSG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine)?
The IUPAC name of 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) (CID 23291525) is 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine).
What is the SMILES notation for 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine)?
The canonical SMILES for 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) is NCCc1ccccc1.NCCc1ccccc1.O=C(O)CCCC(=O)OC(=O)CCCC(=O)O.
What is the InChIKey of 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine)?
The InChIKey is QLGCSZIXFOQYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O7.2C8H11N/c11-7(12)3-1-5-9(15)17-10(16)6-2-4-8(13)14;2*9-7-6-8-4-2-1-3-5-8/h1-6H2,(H,11,12)(H,13,14);2*1-5H,6-7,9H2.
What are the key properties of 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine)?
5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) has a molecular weight of 488.58 g/mol, XLogP of 2.94, 12 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-carboxybutanoyloxy)-5-oxopentanoic acid;bis(2-phenylethanamine) is sourced from PubChem (CID 23291525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).