C17H18O2 — CID 10777333
1-[(1R,2S,3R,4S)-3-acetyl-2-bicyclo[2.2.1]hept-5-enyl]-2-phenylethanone (PubChem CID 10777333) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4S)-3-acetyl-2-bicyclo[2.2.1]hept-5-enyl]-2-phenylethanone.
| Compound Name | 1-[(1R,2S,3R,4S)-3-acetyl-2-bicyclo[2.2.1]hept-5-enyl]-2-phenylethanone |
|---|---|
| PubChem CID | 10777333 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-[(1R,2S,3R,4S)-3-acetyl-2-bicyclo[2.2.1]hept-5-enyl]-2-phenylethanone |
| SMILES | CC(=O)[C@H]1[C@@H](C(=O)Cc2ccccc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H18O2/c1-11(18)16-13-7-8-14(10-13)17(16)15(19)9-12-5-3-2-4-6-12/h2-8,13-14,16-17H,9-10H2,1H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | AVQPKAWEBIBDDA-YALNPMBYSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|