C15H18O4 — CID 68953086
(3Z)-8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,9-diene-7-carboxylic acid (PubChem CID 68953086) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3Z)-8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,9-diene-7-carboxylic acid.
| Compound Name | (3Z)-8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,9-diene-7-carboxylic acid |
|---|---|
| PubChem CID | 68953086 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3Z)-8-prop-2-enoxycarbonylbicyclo[4.2.2]deca-3,9-diene-7-carboxylic acid |
| SMILES | C=CCOC(=O)C1C2C=CC(C/C=C\C2)C1C(=O)O |
| InChI | InChI=1S/C15H18O4/c1-2-9-19-15(18)13-11-6-4-3-5-10(7-8-11)12(13)14(16)17/h2-4,7-8,10-13H,1,5-6,9H2,(H,16,17)/b4-3- |
| InChIKey | SPIXIHKRESFLSS-ARJAWSKDSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|