C18H28O6 — CID 90943534
ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 90943534) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 90943534 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethane;3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC.CCC(C)C(=O)OCCOC(=O)C1C2C=CC(C2)C1C(=O)O |
| InChI | InChI=1S/C16H22O6.C2H6/c1-3-9(2)15(19)21-6-7-22-16(20)13-11-5-4-10(8-11)12(13)14(17)18;1-2/h4-5,9-13H,3,6-8H2,1-2H3,(H,17,18);1-2H3 |
| InChIKey | SVKRABDACTYQBJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|