3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid

C12H20O4 — CID 21351497

IUPAC3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid
SMILESCCC1CC(CC)C(C(=O)OC)C1C(=O)O
InChIInChI=1S/C12H20O4/c1-4-7-6-8(5-2)10(12(15)16-3)9(7)11(13)14/h7-10H,4-6H2,1-3H3,(H,13,14)
InChIKeyNUTAMZDXEKFIIV-UHFFFAOYSA-N
MW228.29 g/mol
LogP1.93
Rot. Bonds4

About 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid

3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid (PubChem CID 21351497) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid
PubChem CID21351497
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid
SMILESCCC1CC(CC)C(C(=O)OC)C1C(=O)O
InChIInChI=1S/C12H20O4/c1-4-7-6-8(5-2)10(12(15)16-3)9(7)11(13)14/h7-10H,4-6H2,1-3H3,(H,13,14)
InChIKeyNUTAMZDXEKFIIV-UHFFFAOYSA-N
XLogP1.93
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid?
The IUPAC name of 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid (CID 21351497) is 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid?
The canonical SMILES for 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid is CCC1CC(CC)C(C(=O)OC)C1C(=O)O.
What is the InChIKey of 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid?
The InChIKey is NUTAMZDXEKFIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-7-6-8(5-2)10(12(15)16-3)9(7)11(13)14/h7-10H,4-6H2,1-3H3,(H,13,14).
What are the key properties of 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid?
3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid has a molecular weight of 228.29 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-2-methoxycarbonylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 21351497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).