C10H13NO2S — CID 73349351
methyl (2S,5S)-5-isothiocyanatobicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 73349351) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is methyl (2S,5S)-5-isothiocyanatobicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (2S,5S)-5-isothiocyanatobicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 73349351 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | methyl (2S,5S)-5-isothiocyanatobicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC2CC1C[C@@H]2N=C=S |
| InChI | InChI=1S/C10H13NO2S/c1-13-10(12)8-3-7-2-6(8)4-9(7)11-5-14/h6-9H,2-4H2,1H3/t6?,7?,8-,9-/m0/s1 |
| InChIKey | DCALCCIPFVJFMU-PEBLOWIWSA-N |
| XLogP | 1.68 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|