About 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone
1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 73355405) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone.
Molecular Properties
| Compound Name | 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone |
| PubChem CID | 73355405 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CC(=O)[C@H]1CC2CC1C[C@@H]2N=C=S |
| InChI | InChI=1S/C10H13NOS/c1-6(12)9-3-8-2-7(9)4-10(8)11-5-13/h7-10H,2-4H2,1H3/t7?,8?,9-,10+/m1/s1 |
| InChIKey | JAFDGJGPXFVHSN-BMNUFHGDSA-N |
| XLogP | 2.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone?
The IUPAC name of 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone (CID 73355405) is 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone.
What is the SMILES notation for 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone?
The canonical SMILES for 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone is CC(=O)[C@H]1CC2CC1C[C@@H]2N=C=S.
What is the InChIKey of 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone?
The InChIKey is JAFDGJGPXFVHSN-BMNUFHGDSA-N. The full InChI is InChI=1S/C10H13NOS/c1-6(12)9-3-8-2-7(9)4-10(8)11-5-13/h7-10H,2-4H2,1H3/t7?,8?,9-,10+/m1/s1.
What are the key properties of 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone?
1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone has a molecular weight of 195.29 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,5S)-5-isothiocyanato-2-bicyclo[2.2.1]heptanyl]ethanone is sourced from PubChem (CID 73355405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).