C8H11NS — CID 11869712
(1S,2S,4R)-2-isothiocyanatobicyclo[2.2.1]heptane (PubChem CID 11869712) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is (1S,2S,4R)-2-isothiocyanatobicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4R)-2-isothiocyanatobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11869712 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (1S,2S,4R)-2-isothiocyanatobicyclo[2.2.1]heptane |
| SMILES | S=C=N[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H11NS/c10-5-9-8-4-6-1-2-7(8)3-6/h6-8H,1-4H2/t6-,7+,8+/m1/s1 |
| InChIKey | RBGDFYZLQKZUCO-CSMHCCOUSA-N |
| XLogP | 2.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|