C12H19NS — CID 88786022
[(1S,2S)-2-isothiocyanatocyclopentyl]cyclohexane (PubChem CID 88786022) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is [(1S,2S)-2-isothiocyanatocyclopentyl]cyclohexane.
| Compound Name | [(1S,2S)-2-isothiocyanatocyclopentyl]cyclohexane |
|---|---|
| PubChem CID | 88786022 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | [(1S,2S)-2-isothiocyanatocyclopentyl]cyclohexane |
| SMILES | S=C=N[C@H]1CCC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C12H19NS/c14-9-13-12-8-4-7-11(12)10-5-2-1-3-6-10/h10-12H,1-8H2/t11-,12-/m0/s1 |
| InChIKey | YGKZYENSIGRIAI-RYUDHWBXSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|