C12H20 — CID 54490019
tricyclo[5.3.2.04,9]dodecane (PubChem CID 54490019) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is tricyclo[5.3.2.04,9]dodecane.
| Compound Name | tricyclo[5.3.2.04,9]dodecane |
|---|---|
| PubChem CID | 54490019 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | tricyclo[5.3.2.04,9]dodecane |
| SMILES | C1CC2CCC3CCC1CC3C2 |
| InChI | InChI=1S/C12H20/c1-2-10-4-6-11-5-3-9(1)7-12(11)8-10/h9-12H,1-8H2 |
| InChIKey | XVARZVAWWFPDLB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |