About bicyclo[2.2.1]heptan-2-amine;platinum(2+)
bicyclo[2.2.1]heptan-2-amine;platinum(2+) (PubChem CID 21144668) has the molecular formula C7H13NPt+2
and a molecular weight of 306.27 g/mol. Its IUPAC name is bicyclo[2.2.1]heptan-2-amine;platinum(2+).
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptan-2-amine;platinum(2+) |
| PubChem CID | 21144668 |
| Molecular Formula | C7H13NPt+2 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | bicyclo[2.2.1]heptan-2-amine;platinum(2+) |
| SMILES | NC1CC2CCC1C2.[Pt+2] |
| InChI | InChI=1S/C7H13N.Pt/c8-7-4-5-1-2-6(7)3-5;/h5-7H,1-4,8H2;/q;+2 |
| InChIKey | PYHLWBUHOHLMFJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[2.2.1]heptan-2-amine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptan-2-amine;platinum(2+)?
The IUPAC name of bicyclo[2.2.1]heptan-2-amine;platinum(2+) (CID 21144668) is bicyclo[2.2.1]heptan-2-amine;platinum(2+).
What is the SMILES notation for bicyclo[2.2.1]heptan-2-amine;platinum(2+)?
The canonical SMILES for bicyclo[2.2.1]heptan-2-amine;platinum(2+) is NC1CC2CCC1C2.[Pt+2].
What is the InChIKey of bicyclo[2.2.1]heptan-2-amine;platinum(2+)?
The InChIKey is PYHLWBUHOHLMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.Pt/c8-7-4-5-1-2-6(7)3-5;/h5-7H,1-4,8H2;/q;+2.
What are the key properties of bicyclo[2.2.1]heptan-2-amine;platinum(2+)?
bicyclo[2.2.1]heptan-2-amine;platinum(2+) has a molecular weight of 306.27 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptan-2-amine;platinum(2+) is sourced from PubChem (CID 21144668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).