C12H21N — CID 89298731
tricyclo[5.3.2.03,9]dodecan-4-amine (PubChem CID 89298731) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is tricyclo[5.3.2.03,9]dodecan-4-amine.
| Compound Name | tricyclo[5.3.2.03,9]dodecan-4-amine |
|---|---|
| PubChem CID | 89298731 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | tricyclo[5.3.2.03,9]dodecan-4-amine |
| SMILES | NC1CCC2CCC3CC(C2)C1C3 |
| InChI | InChI=1S/C12H21N/c13-12-4-3-8-1-2-9-6-10(5-8)11(12)7-9/h8-12H,1-7,13H2 |
| InChIKey | IJNWKNRBUKJVLC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |