C6H11N — CID 91654438
cis-(1R,2S)-2-cyclopropylcyclopropan-1-amine (PubChem CID 91654438) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is cis-(1R,2S)-2-cyclopropylcyclopropan-1-amine.
| Compound Name | cis-(1R,2S)-2-cyclopropylcyclopropan-1-amine |
|---|---|
| PubChem CID | 91654438 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | cis-(1R,2S)-2-cyclopropylcyclopropan-1-amine |
| SMILES | N[C@@H]1C[C@H]1C1CC1 |
| InChI | InChI=1S/C6H11N/c7-6-3-5(6)4-1-2-4/h4-6H,1-3,7H2/t5-,6+/m0/s1 |
| InChIKey | SZVQRCAIAVDYOF-NTSWFWBYSA-N |
| XLogP | 0.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |