C11H19N — CID 89166001
tricyclo[5.3.1.03,9]undecan-2-amine (PubChem CID 89166001) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is tricyclo[5.3.1.03,9]undecan-2-amine.
| Compound Name | tricyclo[5.3.1.03,9]undecan-2-amine |
|---|---|
| PubChem CID | 89166001 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | tricyclo[5.3.1.03,9]undecan-2-amine |
| SMILES | NC1C2CC3CCCC1C(C3)C2 |
| InChI | InChI=1S/C11H19N/c12-11-9-5-7-2-1-3-10(11)8(4-7)6-9/h7-11H,1-6,12H2 |
| InChIKey | YDKBZSQOTDAFIL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |