C7H13K — CID 173241740
potassium;bicyclo[2.2.1]heptane;hydride (PubChem CID 173241740) has the molecular formula C7H13K and a molecular weight of 136.28 g/mol. Its IUPAC name is potassium;bicyclo[2.2.1]heptane;hydride.
| Compound Name | potassium;bicyclo[2.2.1]heptane;hydride |
|---|---|
| PubChem CID | 173241740 |
| Molecular Formula | C7H13K |
| Molecular Weight | 136.28 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | potassium;bicyclo[2.2.1]heptane;hydride |
| SMILES | C1CC2CCC1C2.[H-].[K+] |
| InChI | InChI=1S/C7H12.K.H/c1-2-7-4-3-6(1)5-7;;/h6-7H,1-5H2;;/q;+1;-1 |
| InChIKey | IYOKNSYSGAQSSM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |