About potassium;bicyclo[2.2.1]heptane;hydride
potassium;bicyclo[2.2.1]heptane;hydride (PubChem CID 173241740) has the molecular formula C7H13K
and a molecular weight of 136.28 g/mol. Its IUPAC name is potassium;bicyclo[2.2.1]heptane;hydride.
Molecular Properties
| Compound Name | potassium;bicyclo[2.2.1]heptane;hydride |
| PubChem CID | 173241740 |
| Molecular Formula | C7H13K |
| Molecular Weight | 136.28 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | potassium;bicyclo[2.2.1]heptane;hydride |
| SMILES | C1CC2CCC1C2.[H-].[K+] |
| InChI | InChI=1S/C7H12.K.H/c1-2-7-4-3-6(1)5-7;;/h6-7H,1-5H2;;/q;+1;-1 |
| InChIKey | IYOKNSYSGAQSSM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze potassium;bicyclo[2.2.1]heptane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;bicyclo[2.2.1]heptane;hydride?
The IUPAC name of potassium;bicyclo[2.2.1]heptane;hydride (CID 173241740) is potassium;bicyclo[2.2.1]heptane;hydride.
What is the SMILES notation for potassium;bicyclo[2.2.1]heptane;hydride?
The canonical SMILES for potassium;bicyclo[2.2.1]heptane;hydride is C1CC2CCC1C2.[H-].[K+].
What is the InChIKey of potassium;bicyclo[2.2.1]heptane;hydride?
The InChIKey is IYOKNSYSGAQSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.K.H/c1-2-7-4-3-6(1)5-7;;/h6-7H,1-5H2;;/q;+1;-1.
What are the key properties of potassium;bicyclo[2.2.1]heptane;hydride?
potassium;bicyclo[2.2.1]heptane;hydride has a molecular weight of 136.28 g/mol, XLogP of -0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;bicyclo[2.2.1]heptane;hydride is sourced from PubChem (CID 173241740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).