About bicyclo[2.2.1]heptane;methanimine
bicyclo[2.2.1]heptane;methanimine (PubChem CID 69055097) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;methanimine.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;methanimine |
| PubChem CID | 69055097 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | bicyclo[2.2.1]heptane;methanimine |
| SMILES | C1CC2CCC1C2.[H]N=C |
| InChI | InChI=1S/C7H12.CH3N/c1-2-7-4-3-6(1)5-7;1-2/h6-7H,1-5H2;2H,1H2 |
| InChIKey | QZWZQFUIUVLQPX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;methanimine?
The IUPAC name of bicyclo[2.2.1]heptane;methanimine (CID 69055097) is bicyclo[2.2.1]heptane;methanimine.
What is the SMILES notation for bicyclo[2.2.1]heptane;methanimine?
The canonical SMILES for bicyclo[2.2.1]heptane;methanimine is C1CC2CCC1C2.[H]N=C.
What is the InChIKey of bicyclo[2.2.1]heptane;methanimine?
The InChIKey is QZWZQFUIUVLQPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.CH3N/c1-2-7-4-3-6(1)5-7;1-2/h6-7H,1-5H2;2H,1H2.
What are the key properties of bicyclo[2.2.1]heptane;methanimine?
bicyclo[2.2.1]heptane;methanimine has a molecular weight of 125.22 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;methanimine is sourced from PubChem (CID 69055097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).