C8H15N — CID 69055097
bicyclo[2.2.1]heptane;methanimine (PubChem CID 69055097) has the molecular formula C8H15N and a molecular weight of 125.22 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;methanimine.
| Compound Name | bicyclo[2.2.1]heptane;methanimine |
|---|---|
| PubChem CID | 69055097 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | bicyclo[2.2.1]heptane;methanimine |
| SMILES | C1CC2CCC1C2.[H]N=C |
| InChI | InChI=1S/C7H12.CH3N/c1-2-7-4-3-6(1)5-7;1-2/h6-7H,1-5H2;2H,1H2 |
| InChIKey | QZWZQFUIUVLQPX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|