C12H16O3S — CID 170788080
methyl (1R,6S)-6-prop-2-enylsulfanylcarbonylcyclohex-3-ene-1-carboxylate (PubChem CID 170788080) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is methyl (1R,6S)-6-prop-2-enylsulfanylcarbonylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,6S)-6-prop-2-enylsulfanylcarbonylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 170788080 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | methyl (1R,6S)-6-prop-2-enylsulfanylcarbonylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CCSC(=O)[C@H]1CC=CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H16O3S/c1-3-8-16-12(14)10-7-5-4-6-9(10)11(13)15-2/h3-5,9-10H,1,6-8H2,2H3/t9-,10+/m1/s1 |
| InChIKey | UWIFBQYJEKRHPP-ZJUUUORDSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|