C17H17NO6 — CID 122203802
(1R,6S)-6-[(E)-2-nitro-3-phenylprop-2-enoxy]carbonylcyclohex-3-ene-1-carboxylic acid (PubChem CID 122203802) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is (1R,6S)-6-[(E)-2-nitro-3-phenylprop-2-enoxy]carbonylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[(E)-2-nitro-3-phenylprop-2-enoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 122203802 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (1R,6S)-6-[(E)-2-nitro-3-phenylprop-2-enoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(OC/C(=C\c1ccccc1)[N+](=O)[O-])[C@H]1CC=CC[C@H]1C(=O)O |
| InChI | InChI=1S/C17H17NO6/c19-16(20)14-8-4-5-9-15(14)17(21)24-11-13(18(22)23)10-12-6-2-1-3-7-12/h1-7,10,14-15H,8-9,11H2,(H,19,20)/b13-10+/t14-,15+/m1/s1 |
| InChIKey | JYTZERXPEKYHES-XGWPRKDGSA-N |
| XLogP | 2.51 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|