C17H20O6 — CID 40542924
(1R,6S)-6-[(2,3-dimethoxyphenyl)methoxycarbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 40542924) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (1R,6S)-6-[(2,3-dimethoxyphenyl)methoxycarbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[(2,3-dimethoxyphenyl)methoxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40542924 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (1R,6S)-6-[(2,3-dimethoxyphenyl)methoxycarbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1cccc(COC(=O)[C@H]2CC=CC[C@H]2C(=O)O)c1OC |
| InChI | InChI=1S/C17H20O6/c1-21-14-9-5-6-11(15(14)22-2)10-23-17(20)13-8-4-3-7-12(13)16(18)19/h3-6,9,12-13H,7-8,10H2,1-2H3,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | UMVSFPMJKOWIQI-OLZOCXBDSA-N |
| XLogP | 2.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|