C16H17NO6 — CID 40558460
(1S,6S)-6-[(1S)-1-(3-nitrophenyl)ethoxy]carbonylcyclohex-3-ene-1-carboxylic acid (PubChem CID 40558460) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (1S,6S)-6-[(1S)-1-(3-nitrophenyl)ethoxy]carbonylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[(1S)-1-(3-nitrophenyl)ethoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 40558460 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (1S,6S)-6-[(1S)-1-(3-nitrophenyl)ethoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
| SMILES | C[C@H](OC(=O)[C@H]1CC=CC[C@@H]1C(=O)O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17NO6/c1-10(11-5-4-6-12(9-11)17(21)22)23-16(20)14-8-3-2-7-13(14)15(18)19/h2-6,9-10,13-14H,7-8H2,1H3,(H,18,19)/t10-,13-,14-/m0/s1 |
| InChIKey | PPTUBSSINJWZBK-BPNCWPANSA-N |
| XLogP | 2.87 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|