C20H25ClN2O3 — CID 109132844
1-N-(3-chloro-4-methoxyphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109132844) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 1-N-(3-chloro-4-methoxyphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(3-chloro-4-methoxyphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132844 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-N-(3-chloro-4-methoxyphenyl)-2-N-[2-(cyclohexen-1-yl)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2CC2C(=O)NCCC2=CCCCC2)cc1Cl |
| InChI | InChI=1S/C20H25ClN2O3/c1-26-18-8-7-14(11-17(18)21)23-20(25)16-12-15(16)19(24)22-10-9-13-5-3-2-4-6-13/h5,7-8,11,15-16H,2-4,6,9-10,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | DGRGEYODSQLAFT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|