C20H21F3N4O — CID 109299566
N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide (PubChem CID 109299566) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109299566 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccnc(Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C20H21F3N4O/c21-20(22,23)15-8-4-5-9-16(15)26-19-25-13-11-17(27-19)18(28)24-12-10-14-6-2-1-3-7-14/h4-6,8-9,11,13H,1-3,7,10,12H2,(H,24,28)(H,25,26,27) |
| InChIKey | IFLZQEIXDZEQFF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|