C18H20F3N5 — CID 112943059
5-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112943059) has the molecular formula C18H20F3N5 and a molecular weight of 363.39 g/mol. Its IUPAC name is 5-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943059 |
| Molecular Formula | C18H20F3N5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 5-N-[2-(cyclohexen-1-yl)ethyl]-3-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | FC(F)(F)c1ccccc1Nc1nncc(NCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C18H20F3N5/c19-18(20,21)14-8-4-5-9-15(14)24-17-25-16(12-23-26-17)22-11-10-13-6-2-1-3-7-13/h4-6,8-9,12H,1-3,7,10-11H2,(H2,22,24,25,26) |
| InChIKey | LGDKYIPORGAGIR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|