C15H18N4O2 — CID 80977407
4-N-(1,3-benzodioxol-5-yl)-5-methyl-2-propylpyrimidine-4,6-diamine (PubChem CID 80977407) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-5-methyl-2-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-5-methyl-2-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80977407 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-5-methyl-2-propylpyrimidine-4,6-diamine |
| SMILES | CCCc1nc(N)c(C)c(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C15H18N4O2/c1-3-4-13-18-14(16)9(2)15(19-13)17-10-5-6-11-12(7-10)21-8-20-11/h5-7H,3-4,8H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | ODFVMVMZUWOMNV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |