C13H12ClN5O2 — CID 3514472
2-N-(1,3-benzodioxol-5-yl)-6-chloro-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 3514472) has the molecular formula C13H12ClN5O2 and a molecular weight of 305.73 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-6-chloro-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-6-chloro-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3514472 |
| Molecular Formula | C13H12ClN5O2 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-6-chloro-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Cl)nc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H12ClN5O2/c1-2-5-15-12-17-11(14)18-13(19-12)16-8-3-4-9-10(6-8)21-7-20-9/h2-4,6H,1,5,7H2,(H2,15,16,17,18,19) |
| InChIKey | IJULCPRSKUPLLV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|