C28H37N7O5 — CID 117090641
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 117090641) has the molecular formula C28H37N7O5 and a molecular weight of 551.65 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 117090641 |
| Molecular Formula | C28H37N7O5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Nc2cc(OC)c(OC)c(OC)c2)nc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C28H37N7O5/c1-6-34(7-2)27-30-26(29-20-15-23(36-3)25(38-5)24(16-20)37-4)31-28(32-27)35-12-10-33(11-13-35)17-19-8-9-21-22(14-19)40-18-39-21/h8-9,14-16H,6-7,10-13,17-18H2,1-5H3,(H,29,30,31,32) |
| InChIKey | VGQOQRQXUFNEIT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |