C27H44N8O2 — CID 117088419
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-N-[2-[di(propan-2-yl)amino]ethyl]-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 117088419) has the molecular formula C27H44N8O2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-N-[2-[di(propan-2-yl)amino]ethyl]-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-N-[2-[di(propan-2-yl)amino]ethyl]-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 117088419 |
| Molecular Formula | C27H44N8O2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.36 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-N-[2-[di(propan-2-yl)amino]ethyl]-4-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(NCCN(C(C)C)C(C)C)nc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C27H44N8O2/c1-7-33(8-2)26-29-25(28-11-12-35(20(3)4)21(5)6)30-27(31-26)34-15-13-32(14-16-34)18-22-9-10-23-24(17-22)37-19-36-23/h9-10,17,20-21H,7-8,11-16,18-19H2,1-6H3,(H,28,29,30,31) |
| InChIKey | QTKKZGPQUDMKMG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |