C26H31N9O — CID 117088512
2-N,2-N-diethyl-6-N-(4-imidazol-1-ylphenyl)-4-N-(4-morpholin-4-ylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 117088512) has the molecular formula C26H31N9O and a molecular weight of 485.60 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-N-(4-imidazol-1-ylphenyl)-4-N-(4-morpholin-4-ylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-6-N-(4-imidazol-1-ylphenyl)-4-N-(4-morpholin-4-ylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117088512 |
| Molecular Formula | C26H31N9O |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2-N,2-N-diethyl-6-N-(4-imidazol-1-ylphenyl)-4-N-(4-morpholin-4-ylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(Nc2ccc(N3CCOCC3)cc2)nc(Nc2ccc(-n3ccnc3)cc2)n1 |
| InChI | InChI=1S/C26H31N9O/c1-3-33(4-2)26-31-24(28-20-5-9-22(10-6-20)34-15-17-36-18-16-34)30-25(32-26)29-21-7-11-23(12-8-21)35-14-13-27-19-35/h5-14,19H,3-4,15-18H2,1-2H3,(H2,28,29,30,31,32) |
| InChIKey | BUJASKIJUVUXOR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|