C15H20Cl3N5O5 — CID 110178192
1-O-methyl 4-O-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl] butanedioate (PubChem CID 110178192) has the molecular formula C15H20Cl3N5O5 and a molecular weight of 456.71 g/mol. Its IUPAC name is 1-O-methyl 4-O-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl] butanedioate.
| Compound Name | 1-O-methyl 4-O-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl] butanedioate |
|---|---|
| PubChem CID | 110178192 |
| Molecular Formula | C15H20Cl3N5O5 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 1-O-methyl 4-O-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl] butanedioate |
| SMILES | COC(=O)CCC(=O)OCCNc1nc(N2CCOCC2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C15H20Cl3N5O5/c1-26-10(24)2-3-11(25)28-7-4-19-13-20-12(15(16,17)18)21-14(22-13)23-5-8-27-9-6-23/h2-9H2,1H3,(H,19,20,21,22) |
| InChIKey | KMOCHVGUONZYFE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|