C17H19Cl4N7O4S — CID 110191384
1-(2-chlorophenyl)sulfonyl-3-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl]urea (PubChem CID 110191384) has the molecular formula C17H19Cl4N7O4S and a molecular weight of 559.26 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-3-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl]urea.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-3-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 110191384 |
| Molecular Formula | C17H19Cl4N7O4S |
| Molecular Weight | 559.26 g/mol |
| Exact Mass | 557.00 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-3-[2-[[4-morpholin-4-yl-6-(trichloromethyl)-1,3,5-triazin-2-yl]amino]ethyl]urea |
| SMILES | O=C(NCCNc1nc(N2CCOCC2)nc(C(Cl)(Cl)Cl)n1)NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H19Cl4N7O4S/c18-11-3-1-2-4-12(11)33(30,31)27-16(29)23-6-5-22-14-24-13(17(19,20)21)25-15(26-14)28-7-9-32-10-8-28/h1-4H,5-10H2,(H2,23,27,29)(H,22,24,25,26) |
| InChIKey | NDIMJFGUBPCZHF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|