C18H21ClN4O4S — CID 38142028
3-[(2-chlorophenyl)sulfonylamino]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide (PubChem CID 38142028) has the molecular formula C18H21ClN4O4S and a molecular weight of 424.91 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 38142028 |
| Molecular Formula | C18H21ClN4O4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-(5-morpholin-4-yl-2-pyridinyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1Cl)Nc1ccc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C18H21ClN4O4S/c19-15-3-1-2-4-16(15)28(25,26)21-8-7-18(24)22-17-6-5-14(13-20-17)23-9-11-27-12-10-23/h1-6,13,21H,7-12H2,(H,20,22,24) |
| InChIKey | BDHFKYSDTIZOHL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |